C17H14O3 — CID 68770096
(2E)-2-(4-phenylmethoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene)acetic acid (PubChem CID 68770096) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2E)-2-(4-phenylmethoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene)acetic acid.
| Compound Name | (2E)-2-(4-phenylmethoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene)acetic acid |
|---|---|
| PubChem CID | 68770096 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (2E)-2-(4-phenylmethoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene)acetic acid |
| SMILES | O=C(O)/C=C1\Cc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C17H14O3/c18-17(19)9-14-8-13-6-7-15(10-16(13)14)20-11-12-4-2-1-3-5-12/h1-7,9-10H,8,11H2,(H,18,19)/b14-9+ |
| InChIKey | KCNVJTWCPNUDAH-NTEUORMPSA-N |
| XLogP | 3.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|