C19H18Cl3O3P — CID 139438489
1-methyl-6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde;phosphoryl trichloride (PubChem CID 139438489) has the molecular formula C19H18Cl3O3P and a molecular weight of 431.68 g/mol. Its IUPAC name is 1-methyl-6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde;phosphoryl trichloride.
| Compound Name | 1-methyl-6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde;phosphoryl trichloride |
|---|---|
| PubChem CID | 139438489 |
| Molecular Formula | C19H18Cl3O3P |
| Molecular Weight | 431.68 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 1-methyl-6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde;phosphoryl trichloride |
| SMILES | CC1=C(C=O)CCc2cc(OCc3ccccc3)ccc21.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H18O2.Cl3OP/c1-14-17(12-20)8-7-16-11-18(9-10-19(14)16)21-13-15-5-3-2-4-6-15;1-5(2,3)4/h2-6,9-12H,7-8,13H2,1H3; |
| InChIKey | GPCUYDOQXMMZBF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.68 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|