C23H22BrN3O3 — CID 1397300
[4-[4-[(3-bromo-2-hydroxy-5-methylphenyl)methylideneamino]phenyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 1397300) has the molecular formula C23H22BrN3O3 and a molecular weight of 468.35 g/mol. Its IUPAC name is [4-[4-[(3-bromo-2-hydroxy-5-methylphenyl)methylideneamino]phenyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[4-[(3-bromo-2-hydroxy-5-methylphenyl)methylideneamino]phenyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 1397300 |
| Molecular Formula | C23H22BrN3O3 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | [4-[4-[(3-bromo-2-hydroxy-5-methylphenyl)methylideneamino]phenyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | Cc1cc(Br)c(O)c(/C=N/c2ccc(N3CCN(C(=O)c4ccco4)CC3)cc2)c1 |
| InChI | InChI=1S/C23H22BrN3O3/c1-16-13-17(22(28)20(24)14-16)15-25-18-4-6-19(7-5-18)26-8-10-27(11-9-26)23(29)21-3-2-12-30-21/h2-7,12-15,28H,8-11H2,1H3/b25-15+ |
| InChIKey | HWDPKFJSBIGOBD-MFKUBSTISA-N |
| XLogP | 4.77 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|