C22H19Br2N3O2S — CID 1396278
[4-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 1396278) has the molecular formula C22H19Br2N3O2S and a molecular weight of 549.29 g/mol. Its IUPAC name is [4-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 1396278 |
| Molecular Formula | C22H19Br2N3O2S |
| Molecular Weight | 549.29 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | [4-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(c2ccc(/N=C/c3cc(Br)cc(Br)c3O)cc2)CC1 |
| InChI | InChI=1S/C22H19Br2N3O2S/c23-16-12-15(21(28)19(24)13-16)14-25-17-3-5-18(6-4-17)26-7-9-27(10-8-26)22(29)20-2-1-11-30-20/h1-6,11-14,28H,7-10H2/b25-14+ |
| InChIKey | PJEATXXOXDPXOO-AFUMVMLFSA-N |
| XLogP | 5.69 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|