C17H17BrO2 — CID 171549472
(2E,4E)-1-(3-bromo-2-hydroxy-5-methylphenyl)-4-ethenyl-2-methylhepta-2,4,6-trien-1-one (PubChem CID 171549472) has the molecular formula C17H17BrO2 and a molecular weight of 333.23 g/mol. Its IUPAC name is (2E,4E)-1-(3-bromo-2-hydroxy-5-methylphenyl)-4-ethenyl-2-methylhepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E)-1-(3-bromo-2-hydroxy-5-methylphenyl)-4-ethenyl-2-methylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 171549472 |
| Molecular Formula | C17H17BrO2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (2E,4E)-1-(3-bromo-2-hydroxy-5-methylphenyl)-4-ethenyl-2-methylhepta-2,4,6-trien-1-one |
| SMILES | C=C/C=C(C=C)/C=C(\C)C(=O)c1cc(C)cc(Br)c1O |
| InChI | InChI=1S/C17H17BrO2/c1-5-7-13(6-2)10-12(4)16(19)14-8-11(3)9-15(18)17(14)20/h5-10,20H,1-2H2,3-4H3/b12-10+,13-7+ |
| InChIKey | WLHFPEIXIPMRQS-PVYBRLDNSA-N |
| XLogP | 4.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|