C27H23BrN4O5S2 — CID 23854309
3-(1,3-benzodioxol-5-ylmethylideneamino)-4-(3-bromophenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 23854309) has the molecular formula C27H23BrN4O5S2 and a molecular weight of 627.54 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylideneamino)-4-(3-bromophenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylideneamino)-4-(3-bromophenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23854309 |
| Molecular Formula | C27H23BrN4O5S2 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 626.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylideneamino)-4-(3-bromophenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | O=S(=O)(c1ccc(/N=c2\scc(-c3cccc(Br)c3)n2N=Cc2ccc3c(c2)OCO3)cc1)N1CCOCC1 |
| InChI | InChI=1S/C27H23BrN4O5S2/c28-21-3-1-2-20(15-21)24-17-38-27(32(24)29-16-19-4-9-25-26(14-19)37-18-36-25)30-22-5-7-23(8-6-22)39(33,34)31-10-12-35-13-11-31/h1-9,14-17H,10-13,18H2/b29-16?,30-27- |
| InChIKey | GUHYSLGYZKXPRA-GTUFNBTISA-N |
| XLogP | 4.84 |
| TPSA | 94.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|