C22H22FN3OS — CID 23740645
1-[3-[4-(2-fluorophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one (PubChem CID 23740645) has the molecular formula C22H22FN3OS and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[3-[4-(2-fluorophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-(2-fluorophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 23740645 |
| Molecular Formula | C22H22FN3OS |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1-[3-[4-(2-fluorophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCn1c(-c2ccccc2F)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C22H22FN3OS/c23-19-11-5-4-10-18(19)20-16-28-22(24-17-8-2-1-3-9-17)26(20)15-7-14-25-13-6-12-21(25)27/h1-5,8-11,16H,6-7,12-15H2/b24-22- |
| InChIKey | DIBJZMPRUWMYJR-GYHWCHFESA-N |
| XLogP | 4.60 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|