C14H18FNOS — CID 139017187
1-[3-[(2-fluorophenyl)methylsulfanyl]propyl]pyrrolidin-2-one (PubChem CID 139017187) has the molecular formula C14H18FNOS and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-[3-[(2-fluorophenyl)methylsulfanyl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(2-fluorophenyl)methylsulfanyl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 139017187 |
| Molecular Formula | C14H18FNOS |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-[3-[(2-fluorophenyl)methylsulfanyl]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCSCc1ccccc1F |
| InChI | InChI=1S/C14H18FNOS/c15-13-6-2-1-5-12(13)11-18-10-4-9-16-8-3-7-14(16)17/h1-2,5-6H,3-4,7-11H2 |
| InChIKey | SDASVCZXTMBUFW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|