C16H22FN3OS — CID 8727937
1-(2-fluorophenyl)-3-[3-(2-oxoazepan-1-yl)propyl]thiourea (PubChem CID 8727937) has the molecular formula C16H22FN3OS and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[3-(2-oxoazepan-1-yl)propyl]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[3-(2-oxoazepan-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 8727937 |
| Molecular Formula | C16H22FN3OS |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[3-(2-oxoazepan-1-yl)propyl]thiourea |
| SMILES | O=C1CCCCCN1CCCNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C16H22FN3OS/c17-13-7-3-4-8-14(13)19-16(22)18-10-6-12-20-11-5-1-2-9-15(20)21/h3-4,7-8H,1-2,5-6,9-12H2,(H2,18,19,22) |
| InChIKey | GCRWMKMHTOGBIK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|