C17H26FN3S — CID 100686060
1-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-3-(2-fluorophenyl)thiourea (PubChem CID 100686060) has the molecular formula C17H26FN3S and a molecular weight of 323.48 g/mol. Its IUPAC name is 1-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 100686060 |
| Molecular Formula | C17H26FN3S |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-3-(2-fluorophenyl)thiourea |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C17H26FN3S/c1-2-14-8-5-6-12-21(14)13-7-11-19-17(22)20-16-10-4-3-9-15(16)18/h3-4,9-10,14H,2,5-8,11-13H2,1H3,(H2,19,20,22)/t14-/m1/s1 |
| InChIKey | SNAYEQBCNPZXHV-CQSZACIVSA-N |
| XLogP | 3.77 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|