C21H18BrN5O2S — CID 23795704
4-(2-bromophenyl)-3-(3-imidazol-1-ylpropyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23795704) has the molecular formula C21H18BrN5O2S and a molecular weight of 484.38 g/mol. Its IUPAC name is 4-(2-bromophenyl)-3-(3-imidazol-1-ylpropyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2-bromophenyl)-3-(3-imidazol-1-ylpropyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23795704 |
| Molecular Formula | C21H18BrN5O2S |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 4-(2-bromophenyl)-3-(3-imidazol-1-ylpropyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=c1\scc(-c2ccccc2Br)n1CCCn1ccnc1 |
| InChI | InChI=1S/C21H18BrN5O2S/c22-17-7-2-1-6-16(17)20-14-30-21(24-18-8-3-4-9-19(18)27(28)29)26(20)12-5-11-25-13-10-23-15-25/h1-4,6-10,13-15H,5,11-12H2/b24-21- |
| InChIKey | CKJMDWYXVQLOPT-FLFQWRMESA-N |
| XLogP | 5.41 |
| TPSA | 78.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|