C16H19N3O4 — CID 10567485
ethyl 1,6-dimethyl-2-(2-nitrophenyl)imino-3,4-dihydropyridine-5-carboxylate (PubChem CID 10567485) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is ethyl 1,6-dimethyl-2-(2-nitrophenyl)imino-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 1,6-dimethyl-2-(2-nitrophenyl)imino-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 10567485 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl 1,6-dimethyl-2-(2-nitrophenyl)imino-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(C)/C(=N/c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H19N3O4/c1-4-23-16(20)12-9-10-15(18(3)11(12)2)17-13-7-5-6-8-14(13)19(21)22/h5-8H,4,9-10H2,1-3H3/b17-15+ |
| InChIKey | RXBTZPOMJGCISP-BMRADRMJSA-N |
| XLogP | 3.19 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|