C15H16N2O4 — CID 15814157
ethyl 1,4-dimethyl-3-(2-nitrophenyl)pyrrole-2-carboxylate (PubChem CID 15814157) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is ethyl 1,4-dimethyl-3-(2-nitrophenyl)pyrrole-2-carboxylate.
| Compound Name | ethyl 1,4-dimethyl-3-(2-nitrophenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 15814157 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | ethyl 1,4-dimethyl-3-(2-nitrophenyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2[N+](=O)[O-])c(C)cn1C |
| InChI | InChI=1S/C15H16N2O4/c1-4-21-15(18)14-13(10(2)9-16(14)3)11-7-5-6-8-12(11)17(19)20/h5-9H,4H2,1-3H3 |
| InChIKey | WNVAFRQFUJZSBW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|