C18H25N3O2S — CID 174447038
4-butyl-N-(2-methyl-4-nitrophenyl)-3-(2-methylpropyl)-1,3-thiazol-2-imine (PubChem CID 174447038) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 4-butyl-N-(2-methyl-4-nitrophenyl)-3-(2-methylpropyl)-1,3-thiazol-2-imine.
| Compound Name | 4-butyl-N-(2-methyl-4-nitrophenyl)-3-(2-methylpropyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 174447038 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-butyl-N-(2-methyl-4-nitrophenyl)-3-(2-methylpropyl)-1,3-thiazol-2-imine |
| SMILES | CCCCc1cs/c(=N\c2ccc([N+](=O)[O-])cc2C)n1CC(C)C |
| InChI | InChI=1S/C18H25N3O2S/c1-5-6-7-16-12-24-18(20(16)11-13(2)3)19-17-9-8-15(21(22)23)10-14(17)4/h8-10,12-13H,5-7,11H2,1-4H3/b19-18- |
| InChIKey | WSVSVVQPZIGQIZ-HNENSFHCSA-N |
| XLogP | 5.00 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|