C17H15N3O2S — CID 175238635
3-benzyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 175238635) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-benzyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-benzyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 175238635 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-benzyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1/N=c1\sccn1Cc1ccccc1 |
| InChI | InChI=1S/C17H15N3O2S/c1-13-11-15(20(21)22)7-8-16(13)18-17-19(9-10-23-17)12-14-5-3-2-4-6-14/h2-11H,12H2,1H3/b18-17- |
| InChIKey | LQOROVIPSWDLQP-ZCXUNETKSA-N |
| XLogP | 4.05 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|