C18H12N4O6S — CID 126211479
3,5-dinitro-N-(3-phenacyl-1,3-thiazol-2-ylidene)benzamide (PubChem CID 126211479) has the molecular formula C18H12N4O6S and a molecular weight of 412.38 g/mol. Its IUPAC name is 3,5-dinitro-N-(3-phenacyl-1,3-thiazol-2-ylidene)benzamide.
| Compound Name | 3,5-dinitro-N-(3-phenacyl-1,3-thiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 126211479 |
| Molecular Formula | C18H12N4O6S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 3,5-dinitro-N-(3-phenacyl-1,3-thiazol-2-ylidene)benzamide |
| SMILES | O=C(Cn1ccs/c1=N/C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C18H12N4O6S/c23-16(12-4-2-1-3-5-12)11-20-6-7-29-18(20)19-17(24)13-8-14(21(25)26)10-15(9-13)22(27)28/h1-10H,11H2/b19-18+ |
| InChIKey | AYLPRKVTAZMXOY-VHEBQXMUSA-N |
| XLogP | 2.99 |
| TPSA | 137.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|