C11H10BrN3O3S — CID 2828882
2-(2-imino-1,3-thiazol-3-yl)-1-(3-nitrophenyl)ethanone;hydrobromide (PubChem CID 2828882) has the molecular formula C11H10BrN3O3S and a molecular weight of 344.19 g/mol. Its IUPAC name is 2-(2-imino-1,3-thiazol-3-yl)-1-(3-nitrophenyl)ethanone;hydrobromide.
| Compound Name | 2-(2-imino-1,3-thiazol-3-yl)-1-(3-nitrophenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 2828882 |
| Molecular Formula | C11H10BrN3O3S |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 2-(2-imino-1,3-thiazol-3-yl)-1-(3-nitrophenyl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=c1\sccn1CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9N3O3S.BrH/c12-11-13(4-5-18-11)7-10(15)8-2-1-3-9(6-8)14(16)17;/h1-6,12H,7H2;1H/b12-11-; |
| InChIKey | ZYUKSHLDNQKTOO-AFEZEDKISA-N |
| XLogP | 2.40 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|