C16H11FN4O3S — CID 7318504
2-[5-(2-fluorophenyl)-2-imino-1,3,4-thiadiazol-3-yl]-1-(3-nitrophenyl)ethanone (PubChem CID 7318504) has the molecular formula C16H11FN4O3S and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-2-imino-1,3,4-thiadiazol-3-yl]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[5-(2-fluorophenyl)-2-imino-1,3,4-thiadiazol-3-yl]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 7318504 |
| Molecular Formula | C16H11FN4O3S |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-2-imino-1,3,4-thiadiazol-3-yl]-1-(3-nitrophenyl)ethanone |
| SMILES | [H]/N=c1\sc(-c2ccccc2F)nn1CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11FN4O3S/c17-13-7-2-1-6-12(13)15-19-20(16(18)25-15)9-14(22)10-4-3-5-11(8-10)21(23)24/h1-8,18H,9H2/b18-16- |
| InChIKey | DOXNVWVVLCXKFK-VLGSPTGOSA-N |
| XLogP | 3.02 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|