C16H10BF5N4O2S — CID 163355522
2-(2-fluorophenyl)-6-(3-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole;hydron;tetrafluoroborate (PubChem CID 163355522) has the molecular formula C16H10BF5N4O2S and a molecular weight of 428.15 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-6-(3-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole;hydron;tetrafluoroborate.
| Compound Name | 2-(2-fluorophenyl)-6-(3-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole;hydron;tetrafluoroborate |
|---|---|
| PubChem CID | 163355522 |
| Molecular Formula | C16H10BF5N4O2S |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-(2-fluorophenyl)-6-(3-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole;hydron;tetrafluoroborate |
| SMILES | F[B-](F)(F)F.O=[N+]([O-])c1cccc(-c2cn3nc(-c4ccccc4F)sc3n2)c1.[H+] |
| InChI | InChI=1S/C16H9FN4O2S.BF4/c17-13-7-2-1-6-12(13)15-19-20-9-14(18-16(20)24-15)10-4-3-5-11(8-10)21(22)23;2-1(3,4)5/h1-9H;/q;-1/p+1 |
| InChIKey | JXUNIMUGCQDMOJ-UHFFFAOYSA-O |
| XLogP | 5.58 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|