C16H8BrClN4O2S — CID 71505007
6-(4-bromophenyl)-2-(2-chloro-5-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 71505007) has the molecular formula C16H8BrClN4O2S and a molecular weight of 435.69 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2-(2-chloro-5-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-(4-bromophenyl)-2-(2-chloro-5-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 71505007 |
| Molecular Formula | C16H8BrClN4O2S |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | 6-(4-bromophenyl)-2-(2-chloro-5-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(-c2nn3cc(-c4ccc(Br)cc4)nc3s2)c1 |
| InChI | InChI=1S/C16H8BrClN4O2S/c17-10-3-1-9(2-4-10)14-8-21-16(19-14)25-15(20-21)12-7-11(22(23)24)5-6-13(12)18/h1-8H |
| InChIKey | ZQSJQCCIFOLVNF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|