C12H6BrClN4O2 — CID 90411524
6-bromo-2-(2-chloro-5-nitrophenyl)imidazo[1,2-a]pyrimidine (PubChem CID 90411524) has the molecular formula C12H6BrClN4O2 and a molecular weight of 353.56 g/mol. Its IUPAC name is 6-bromo-2-(2-chloro-5-nitrophenyl)imidazo[1,2-a]pyrimidine.
| Compound Name | 6-bromo-2-(2-chloro-5-nitrophenyl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 90411524 |
| Molecular Formula | C12H6BrClN4O2 |
| Molecular Weight | 353.56 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | 6-bromo-2-(2-chloro-5-nitrophenyl)imidazo[1,2-a]pyrimidine |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(-c2cn3cc(Br)cnc3n2)c1 |
| InChI | InChI=1S/C12H6BrClN4O2/c13-7-4-15-12-16-11(6-17(12)5-7)9-3-8(18(19)20)1-2-10(9)14/h1-6H |
| InChIKey | GJKFSLKZXKOTPZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|