C10H6N4O2S — CID 2806480
6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 2806480) has the molecular formula C10H6N4O2S and a molecular weight of 246.25 g/mol. Its IUPAC name is 6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 2806480 |
| Molecular Formula | C10H6N4O2S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cn3ncsc3n2)cc1 |
| InChI | InChI=1S/C10H6N4O2S/c15-14(16)8-3-1-7(2-4-8)9-5-13-10(12-9)17-6-11-13/h1-6H |
| InChIKey | KJVMKUGUQCRPKW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|