C23H11N11O4S2 — CID 73346282
6-(3-nitrophenyl)-3-[6-[6-(3-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-pyridinyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 73346282) has the molecular formula C23H11N11O4S2 and a molecular weight of 569.55 g/mol. Its IUPAC name is 6-(3-nitrophenyl)-3-[6-[6-(3-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-pyridinyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(3-nitrophenyl)-3-[6-[6-(3-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-pyridinyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 73346282 |
| Molecular Formula | C23H11N11O4S2 |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | 6-(3-nitrophenyl)-3-[6-[6-(3-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-pyridinyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nn3c(-c4cccc(-c5nnc6sc(-c7cccc([N+](=O)[O-])c7)nn56)n4)nnc3s2)c1 |
| InChI | InChI=1S/C23H11N11O4S2/c35-33(36)14-6-1-4-12(10-14)20-29-31-18(25-27-22(31)39-20)16-8-3-9-17(24-16)19-26-28-23-32(19)30-21(40-23)13-5-2-7-15(11-13)34(37)38/h1-11H |
| InChIKey | LSVHHMZCJAIRLS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 185.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|