C18H11N5O3S — CID 91963012
3-(3-methyl-1-benzofuran-2-yl)-6-(4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 91963012) has the molecular formula C18H11N5O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is 3-(3-methyl-1-benzofuran-2-yl)-6-(4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(3-methyl-1-benzofuran-2-yl)-6-(4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 91963012 |
| Molecular Formula | C18H11N5O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-(3-methyl-1-benzofuran-2-yl)-6-(4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1c(-c2nnc3sc(-c4ccc([N+](=O)[O-])cc4)nn23)oc2ccccc12 |
| InChI | InChI=1S/C18H11N5O3S/c1-10-13-4-2-3-5-14(13)26-15(10)16-19-20-18-22(16)21-17(27-18)11-6-8-12(9-7-11)23(24)25/h2-9H,1H3 |
| InChIKey | RASDUZIGSHSXBR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|