C21H13N5O3S — CID 91963109
2-[[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]isoindole-1,3-dione (PubChem CID 91963109) has the molecular formula C21H13N5O3S and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-[[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91963109 |
| Molecular Formula | C21H13N5O3S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-[[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1c(-c2nnc3sc(CN4C(=O)c5ccccc5C4=O)nn23)oc2ccccc12 |
| InChI | InChI=1S/C21H13N5O3S/c1-11-12-6-4-5-9-15(12)29-17(11)18-22-23-21-26(18)24-16(30-21)10-25-19(27)13-7-2-3-8-14(13)20(25)28/h2-9H,10H2,1H3 |
| InChIKey | HRXCNLXSHPHOAV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|