C18H12N6O2S — CID 4900670
2-[2-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]isoindole-1,3-dione (PubChem CID 4900670) has the molecular formula C18H12N6O2S and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-[2-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4900670 |
| Molecular Formula | C18H12N6O2S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-[2-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1nn2c(-c3cccnc3)nnc2s1 |
| InChI | InChI=1S/C18H12N6O2S/c25-16-12-5-1-2-6-13(12)17(26)23(16)9-7-14-22-24-15(20-21-18(24)27-14)11-4-3-8-19-10-11/h1-6,8,10H,7,9H2 |
| InChIKey | VFSWKXUOMOHXLA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|