C17H12N6S2 — CID 6471901
2-[2-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]-1,3-benzothiazole (PubChem CID 6471901) has the molecular formula C17H12N6S2 and a molecular weight of 364.46 g/mol. Its IUPAC name is 2-[2-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 6471901 |
| Molecular Formula | C17H12N6S2 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-[2-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]-1,3-benzothiazole |
| SMILES | c1cncc(-c2nnc3sc(CCc4nc5ccccc5s4)nn23)c1 |
| InChI | InChI=1S/C17H12N6S2/c1-2-6-13-12(5-1)19-14(24-13)7-8-15-22-23-16(20-21-17(23)25-15)11-4-3-9-18-10-11/h1-6,9-10H,7-8H2 |
| InChIKey | PVIUSXUGMWMIRB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |