C16H11N5S3 — CID 6500135
2-[2-(3-thiophen-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]-1,3-benzothiazole (PubChem CID 6500135) has the molecular formula C16H11N5S3 and a molecular weight of 369.50 g/mol. Its IUPAC name is 2-[2-(3-thiophen-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(3-thiophen-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 6500135 |
| Molecular Formula | C16H11N5S3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-[2-(3-thiophen-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]-1,3-benzothiazole |
| SMILES | c1csc(-c2nnc3sc(CCc4nc5ccccc5s4)nn23)c1 |
| InChI | InChI=1S/C16H11N5S3/c1-2-5-11-10(4-1)17-13(23-11)7-8-14-20-21-15(12-6-3-9-22-12)18-19-16(21)24-14/h1-6,9H,7-8H2 |
| InChIKey | OXVWPFOYGWZDGF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |