C13H12N6S2 — CID 45494735
3-thiophen-2-yl-6-(1,3,5-trimethylpyrazol-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 45494735) has the molecular formula C13H12N6S2 and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-thiophen-2-yl-6-(1,3,5-trimethylpyrazol-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-thiophen-2-yl-6-(1,3,5-trimethylpyrazol-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 45494735 |
| Molecular Formula | C13H12N6S2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-thiophen-2-yl-6-(1,3,5-trimethylpyrazol-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1nn(C)c(C)c1-c1nn2c(-c3cccs3)nnc2s1 |
| InChI | InChI=1S/C13H12N6S2/c1-7-10(8(2)18(3)16-7)12-17-19-11(9-5-4-6-20-9)14-15-13(19)21-12/h4-6H,1-3H3 |
| InChIKey | ZMBWWKJTYDFZCV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |