C25H21N5O3S — CID 91963112
2-[5-[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentyl]isoindole-1,3-dione (PubChem CID 91963112) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-[5-[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91963112 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-[5-[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentyl]isoindole-1,3-dione |
| SMILES | Cc1c(-c2nnc3sc(CCCCCN4C(=O)c5ccccc5C4=O)nn23)oc2ccccc12 |
| InChI | InChI=1S/C25H21N5O3S/c1-15-16-9-6-7-12-19(16)33-21(15)22-26-27-25-30(22)28-20(34-25)13-3-2-8-14-29-23(31)17-10-4-5-11-18(17)24(29)32/h4-7,9-12H,2-3,8,13-14H2,1H3 |
| InChIKey | ONYHFNPMERVPAP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 93.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|