C21H26N6O2S — CID 56736857
2-[5-[3-(diethylaminomethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentyl]isoindole-1,3-dione (PubChem CID 56736857) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 2-[5-[3-(diethylaminomethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[3-(diethylaminomethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 56736857 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[5-[3-(diethylaminomethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentyl]isoindole-1,3-dione |
| SMILES | CCN(CC)Cc1nnc2sc(CCCCCN3C(=O)c4ccccc4C3=O)nn12 |
| InChI | InChI=1S/C21H26N6O2S/c1-3-25(4-2)14-17-22-23-21-27(17)24-18(30-21)12-6-5-9-13-26-19(28)15-10-7-8-11-16(15)20(26)29/h7-8,10-11H,3-6,9,12-14H2,1-2H3 |
| InChIKey | NSNORNHTFDNYTO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|