C14H14N4O2S — CID 114352690
5-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)pentanoic acid (PubChem CID 114352690) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)pentanoic acid.
| Compound Name | 5-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)pentanoic acid |
|---|---|
| PubChem CID | 114352690 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)pentanoic acid |
| SMILES | O=C(O)CCCCc1nn2c(-c3ccccc3)nnc2s1 |
| InChI | InChI=1S/C14H14N4O2S/c19-12(20)9-5-4-8-11-17-18-13(15-16-14(18)21-11)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,19,20) |
| InChIKey | LAOXBWNVZGPWHR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|