C15H19N5S — CID 114353253
3-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-N-propan-2-ylpropan-1-amine (PubChem CID 114353253) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 3-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 114353253 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NCCCc1nn2c(-c3ccccc3)nnc2s1 |
| InChI | InChI=1S/C15H19N5S/c1-11(2)16-10-6-9-13-19-20-14(17-18-15(20)21-13)12-7-4-3-5-8-12/h3-5,7-8,11,16H,6,9-10H2,1-2H3 |
| InChIKey | KUNMAZLZJBNQCG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|