C15H19N5S — CID 114353324
3,3-dimethyl-1-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)butan-2-amine (PubChem CID 114353324) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)butan-2-amine.
| Compound Name | 3,3-dimethyl-1-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)butan-2-amine |
|---|---|
| PubChem CID | 114353324 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3,3-dimethyl-1-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)butan-2-amine |
| SMILES | CC(C)(C)C(N)Cc1nn2c(-c3ccccc3)nnc2s1 |
| InChI | InChI=1S/C15H19N5S/c1-15(2,3)11(16)9-12-19-20-13(17-18-14(20)21-12)10-7-5-4-6-8-10/h4-8,11H,9,16H2,1-3H3 |
| InChIKey | YPWAWNZFMWXWJL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |