C14H11N5S2 — CID 51048558
6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 51048558) has the molecular formula C14H11N5S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 51048558 |
| Molecular Formula | C14H11N5S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1nc(Cc2nn3c(-c4ccccc4)nnc3s2)cs1 |
| InChI | InChI=1S/C14H11N5S2/c1-9-15-11(8-20-9)7-12-18-19-13(16-17-14(19)21-12)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | OOJUDVAHEMXSBJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |