C15H13N5OS2 — CID 39341739
3-(4-methoxyphenyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 39341739) has the molecular formula C15H13N5OS2 and a molecular weight of 343.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(4-methoxyphenyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 39341739 |
| Molecular Formula | C15H13N5OS2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 3-(4-methoxyphenyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1ccc(-c2nnc3sc(Cc4csc(C)n4)nn23)cc1 |
| InChI | InChI=1S/C15H13N5OS2/c1-9-16-11(8-22-9)7-13-19-20-14(17-18-15(20)23-13)10-3-5-12(21-2)6-4-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | CEJMGVAUCRFEQF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |