C13H13N5S — CID 114353248
N-[(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]prop-2-en-1-amine (PubChem CID 114353248) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is N-[(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 114353248 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-[(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1nn2c(-c3ccccc3)nnc2s1 |
| InChI | InChI=1S/C13H13N5S/c1-2-8-14-9-11-17-18-12(15-16-13(18)19-11)10-6-4-3-5-7-10/h2-7,14H,1,8-9H2 |
| InChIKey | NPULNLNRBOONHF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|