C11H19N5S — CID 114354219
1-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,3-dimethylbutan-2-amine (PubChem CID 114354219) has the molecular formula C11H19N5S and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,3-dimethylbutan-2-amine.
| Compound Name | 1-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 114354219 |
| Molecular Formula | C11H19N5S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,3-dimethylbutan-2-amine |
| SMILES | CCc1nnc2sc(CC(N)C(C)(C)C)nn12 |
| InChI | InChI=1S/C11H19N5S/c1-5-8-13-14-10-16(8)15-9(17-10)6-7(12)11(2,3)4/h7H,5-6,12H2,1-4H3 |
| InChIKey | PZDUUJZRRPLSRH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |