C23H20N4O6S — CID 86206691
[2,6-dimethoxy-4-[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl] ethyl carbonate (PubChem CID 86206691) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl] ethyl carbonate.
| Compound Name | [2,6-dimethoxy-4-[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 86206691 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [2,6-dimethoxy-4-[3-(3-methyl-1-benzofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1c(OC)cc(-c2nn3c(-c4oc5ccccc5c4C)nnc3s2)cc1OC |
| InChI | InChI=1S/C23H20N4O6S/c1-5-31-23(28)33-19-16(29-3)10-13(11-17(19)30-4)21-26-27-20(24-25-22(27)34-21)18-12(2)14-8-6-7-9-15(14)32-18/h6-11H,5H2,1-4H3 |
| InChIKey | LMAFVIMATLOXOU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 110.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|