C23H13ClN6O2S — CID 135423967
3-(5-chloro-3-phenyl-1H-indol-2-yl)-6-(4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 135423967) has the molecular formula C23H13ClN6O2S and a molecular weight of 472.92 g/mol. Its IUPAC name is 3-(5-chloro-3-phenyl-1H-indol-2-yl)-6-(4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(5-chloro-3-phenyl-1H-indol-2-yl)-6-(4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 135423967 |
| Molecular Formula | C23H13ClN6O2S |
| Molecular Weight | 472.92 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 3-(5-chloro-3-phenyl-1H-indol-2-yl)-6-(4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nn3c(-c4[nH]c5ccc(Cl)cc5c4-c4ccccc4)nnc3s2)cc1 |
| InChI | InChI=1S/C23H13ClN6O2S/c24-15-8-11-18-17(12-15)19(13-4-2-1-3-5-13)20(25-18)21-26-27-23-29(21)28-22(33-23)14-6-9-16(10-7-14)30(31)32/h1-12,25H |
| InChIKey | RSCKGUBEHVXEHV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.92 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|