C18H11N7O2S — CID 30372248
6-(4-nitrophenyl)-3-(3-phenyl-1H-pyrazol-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 30372248) has the molecular formula C18H11N7O2S and a molecular weight of 389.40 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-3-(3-phenyl-1H-pyrazol-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(4-nitrophenyl)-3-(3-phenyl-1H-pyrazol-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 30372248 |
| Molecular Formula | C18H11N7O2S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 6-(4-nitrophenyl)-3-(3-phenyl-1H-pyrazol-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nn3c(-c4cc(-c5ccccc5)n[nH]4)nnc3s2)cc1 |
| InChI | InChI=1S/C18H11N7O2S/c26-25(27)13-8-6-12(7-9-13)17-23-24-16(21-22-18(24)28-17)15-10-14(19-20-15)11-4-2-1-3-5-11/h1-10H,(H,19,20) |
| InChIKey | REOHZCIEXVBYQI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|