C13H12N6O2S — CID 10757766
3-(3-nitrophenyl)-6-[(2S)-pyrrolidin-2-yl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 10757766) has the molecular formula C13H12N6O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-6-[(2S)-pyrrolidin-2-yl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(3-nitrophenyl)-6-[(2S)-pyrrolidin-2-yl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 10757766 |
| Molecular Formula | C13H12N6O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-(3-nitrophenyl)-6-[(2S)-pyrrolidin-2-yl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc3sc([C@@H]4CCCN4)nn23)c1 |
| InChI | InChI=1S/C13H12N6O2S/c20-19(21)9-4-1-3-8(7-9)11-15-16-13-18(11)17-12(22-13)10-5-2-6-14-10/h1,3-4,7,10,14H,2,5-6H2/t10-/m0/s1 |
| InChIKey | YGCDDAIDICUGMN-JTQLQIEISA-N |
| XLogP | 2.19 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|