C16H8N4O4S2 — CID 88596231
2,5-bis(3-nitrophenyl)-[1,3]thiazolo[4,5-d][1,3]thiazole (PubChem CID 88596231) has the molecular formula C16H8N4O4S2 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2,5-bis(3-nitrophenyl)-[1,3]thiazolo[4,5-d][1,3]thiazole.
| Compound Name | 2,5-bis(3-nitrophenyl)-[1,3]thiazolo[4,5-d][1,3]thiazole |
|---|---|
| PubChem CID | 88596231 |
| Molecular Formula | C16H8N4O4S2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 2,5-bis(3-nitrophenyl)-[1,3]thiazolo[4,5-d][1,3]thiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3nc(-c4cccc([N+](=O)[O-])c4)sc3s2)c1 |
| InChI | InChI=1S/C16H8N4O4S2/c21-19(22)11-5-1-3-9(7-11)14-17-13-16(25-14)26-15(18-13)10-4-2-6-12(8-10)20(23)24/h1-8H |
| InChIKey | XZVMBWPTYJUMBC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|