C16H12N4O5S — CID 4058561
N-(3,4-dimethyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide (PubChem CID 4058561) has the molecular formula C16H12N4O5S and a molecular weight of 372.36 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide.
| Compound Name | N-(3,4-dimethyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4058561 |
| Molecular Formula | C16H12N4O5S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-(3,4-dimethyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
| SMILES | Cc1cccc2s/c(=N\C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)n(C)c12 |
| InChI | InChI=1S/C16H12N4O5S/c1-9-4-3-5-13-14(9)18(2)16(26-13)17-15(21)10-6-11(19(22)23)8-12(7-10)20(24)25/h3-8H,1-2H3/b17-16- |
| InChIKey | WVJPPSMUGMRXBY-MSUUIHNZSA-N |
| XLogP | 3.11 |
| TPSA | 120.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|