C17H14N4O7S — CID 40885472
N-(4,7-dimethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide (PubChem CID 40885472) has the molecular formula C17H14N4O7S and a molecular weight of 418.39 g/mol. Its IUPAC name is N-(4,7-dimethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide.
| Compound Name | N-(4,7-dimethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 40885472 |
| Molecular Formula | C17H14N4O7S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-(4,7-dimethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
| SMILES | COc1ccc(OC)c2c1s/c(=N\C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)n2C |
| InChI | InChI=1S/C17H14N4O7S/c1-19-14-12(27-2)4-5-13(28-3)15(14)29-17(19)18-16(22)9-6-10(20(23)24)8-11(7-9)21(25)26/h4-8H,1-3H3/b18-17- |
| InChIKey | IGHAAXZAVDEKDA-ZCXUNETKSA-N |
| XLogP | 2.81 |
| TPSA | 139.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|