C19H17N3O5S — CID 78698939
N-(4,7-dimethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 78698939) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is N-(4,7-dimethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-(4,7-dimethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78698939 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-(4,7-dimethoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c2c1s/c(=N\C(=O)C=Cc1cccc([N+](=O)[O-])c1)n2C |
| InChI | InChI=1S/C19H17N3O5S/c1-21-17-14(26-2)8-9-15(27-3)18(17)28-19(21)20-16(23)10-7-12-5-4-6-13(11-12)22(24)25/h4-11H,1-3H3/b10-7?,20-19- |
| InChIKey | XMPCTGZAPJQNBR-BTBSJXTDSA-N |
| XLogP | 3.31 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|