C17H15N3O4S — CID 2150968
N-(4-methoxy-3,7-dimethyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide (PubChem CID 2150968) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is N-(4-methoxy-3,7-dimethyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide.
| Compound Name | N-(4-methoxy-3,7-dimethyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide |
|---|---|
| PubChem CID | 2150968 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(4-methoxy-3,7-dimethyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide |
| SMILES | COc1ccc(C)c2s/c(=N\C(=O)c3ccccc3[N+](=O)[O-])n(C)c12 |
| InChI | InChI=1S/C17H15N3O4S/c1-10-8-9-13(24-3)14-15(10)25-17(19(14)2)18-16(21)11-6-4-5-7-12(11)20(22)23/h4-9H,1-3H3/b18-17- |
| InChIKey | SIXXJZBNKQFMGO-ZCXUNETKSA-N |
| XLogP | 3.21 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|