About 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide
4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide (PubChem CID 38163157) has the molecular formula C12H10N4O5S
and a molecular weight of 322.30 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide.
Molecular Properties
| Compound Name | 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide |
| PubChem CID | 38163157 |
| Molecular Formula | C12H10N4O5S |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)/N=c2\sccn2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N4O5S/c1-7-9(15(18)19)5-8(6-10(7)16(20)21)11(17)13-12-14(2)3-4-22-12/h3-6H,1-2H3/b13-12- |
| InChIKey | QNOQNSRLAPANDO-SEYXRHQNSA-N |
| XLogP | 1.95 |
| TPSA | 120.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide?
The IUPAC name of 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide (CID 38163157) is 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide.
What is the SMILES notation for 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide?
The canonical SMILES for 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide is Cc1c([N+](=O)[O-])cc(C(=O)/N=c2\sccn2C)cc1[N+](=O)[O-].
What is the InChIKey of 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide?
The InChIKey is QNOQNSRLAPANDO-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H10N4O5S/c1-7-9(15(18)19)5-8(6-10(7)16(20)21)11(17)13-12-14(2)3-4-22-12/h3-6H,1-2H3/b13-12-.
What are the key properties of 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide?
4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide has a molecular weight of 322.30 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)-3,5-dinitrobenzamide is sourced from PubChem (CID 38163157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).