C18H14ClN3O4S — CID 7434085
N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-2-(4-nitrophenoxy)acetamide (PubChem CID 7434085) has the molecular formula C18H14ClN3O4S and a molecular weight of 403.85 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7434085 |
| Molecular Formula | C18H14ClN3O4S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)/N=c1\sccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C18H14ClN3O4S/c19-16-4-2-1-3-13(16)11-21-9-10-27-18(21)20-17(23)12-26-15-7-5-14(6-8-15)22(24)25/h1-10H,11-12H2/b20-18- |
| InChIKey | HWOBPVXCDHUCMT-ZZEZOPTASA-N |
| XLogP | 3.67 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|