C18H21ClN2O3S — CID 55718292
N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(oxolan-2-ylmethoxy)propanamide (PubChem CID 55718292) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 55718292 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[3-[(2-chlorophenyl)methyl]-1,3-thiazol-2-ylidene]-3-(oxolan-2-ylmethoxy)propanamide |
| SMILES | O=C(CCOCC1CCCO1)/N=c1\sccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C18H21ClN2O3S/c19-16-6-2-1-4-14(16)12-21-8-11-25-18(21)20-17(22)7-10-23-13-15-5-3-9-24-15/h1-2,4,6,8,11,15H,3,5,7,9-10,12-13H2/b20-18- |
| InChIKey | VMCLTSMJFYHFEA-ZZEZOPTASA-N |
| XLogP | 3.26 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|